Products 1266692-14-1
CAS 1266692-14-1 appears in our catalog under these names: 1H-Indol-3-ylmethanamine hydrochloride, 95%, (1H-Indol-3-yl)methanamine Hydrochloride, >95% (HPLC), 1H-Indol-3-ylmethanamine hydrochloride, (1H-Indol-3-yl)methanamine hydrochloride 98%, (1H-Indol-3-yl)methanamine hydrochloride, 95%, 95%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 25g, 1g, 5g, 250mg, 100mg.
1H-indol-3-ylmethanamine;hydrochloride (CAS 1266692-14-1) is a chemical compound with the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. IUPAC name: 1H-indol-3-ylmethanamine;hydrochloride. InChIKey: GOWCWBKBWLNFCM-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2 |
|---|---|
| Molecular weight | 182.65 g/mol |
| IUPAC name | 1H-indol-3-ylmethanamine;hydrochloride |
| InChIKey | GOWCWBKBWLNFCM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CN.Cl |
Computed by PubChem (NCBI)