Products 126690-96-8
CAS 126690-96-8 appears in our catalog under these names: 9-Bromo-9,10-dihydro-9,10-ethenoanthracene, 95%, 9-Bromo-9,10-dihydro-9,10-ethenoanthracene, 95+%, 9–Bromodibenzobarrelene, 9-Bromo-9,10-dihydro-9,10-ethenoanthracene, >98.0%(GC), 9-Bromo-9，10-dihydro-9，10-ethenoanthracene. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 250mg, 200mg.
1-bromotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene (CAS 126690-96-8) is a chemical compound with the molecular formula C16H11Br and a molecular weight of 283.16 g/mol. IUPAC name: 1-bromotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene. InChIKey: JNPBTNVWRDISGS-UHFFFAOYSA-N.
| Molecular formula | C16H11Br |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | 1-bromotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaene |
| InChIKey | JNPBTNVWRDISGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3C=CC2(C4=CC=CC=C34)Br |
Computed by PubChem (NCBI)