CAS 1266930-11-3 appears in our catalog under these names: 1-Isopropyl-5-(trifluoromethyl)-1H-1,2,3-triazole-4-carboxylic acid, 97%, 1-(Propan-2-yl)-5-(trifluoromethyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
1-propan-2-yl-5-(trifluoromethyl)triazole-4-carboxylic acid (CAS 1266930-11-3) is a chemical compound with the molecular formula C7H8F3N3O2 and a molecular weight of 223.15 g/mol. IUPAC name: 1-propan-2-yl-5-(trifluoromethyl)triazole-4-carboxylic acid. InChIKey: IWSZDSRUSDIUMV-UHFFFAOYSA-N.
| Molecular formula | C7H8F3N3O2 |
|---|---|
| Molecular weight | 223.15 g/mol |
| IUPAC name | 1-propan-2-yl-5-(trifluoromethyl)triazole-4-carboxylic acid |
| InChIKey | IWSZDSRUSDIUMV-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=C(N=N1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)