CAS 126715-04-6 appears in our catalog under these names: 5-Bromo-2-thiophenesulfinic acid, sodium salt, 95%, 95%, 5-Bromo-2-thiophenesulfinic acid, sodium salt, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Sodium 5-bromothiophene-2-sulfinate (CAS 126715-04-6) is a chemical compound with the molecular formula C4H2BrNaO2S2 and a molecular weight of 249.1 g/mol. IUPAC name: sodium 5-bromothiophene-2-sulfinate. InChIKey: IEVOQJORLJHRHH-UHFFFAOYSA-M.
| Molecular formula | C4H2BrNaO2S2 |
|---|---|
| Molecular weight | 249.1 g/mol |
| IUPAC name | sodium 5-bromothiophene-2-sulfinate |
| InChIKey | IEVOQJORLJHRHH-UHFFFAOYSA-M |
| SMILES | C1=C(SC(=C1)Br)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)