Products 1267274-34-9

CAS 1267274-34-9 is the registry number for 1-(4-bromophenyl)-2-oxopyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-(4-bromophenyl)-2-oxopyridine-3-carboxylic acid (CAS 1267274-34-9) is a chemical compound with the molecular formula C12H8BrNO3 and a molecular weight of 294.10 g/mol. IUPAC name: 1-(4-bromophenyl)-2-oxopyridine-3-carboxylic acid. InChIKey: LTVQDBQFUUNCHE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8BrNO3
Molecular weight294.10 g/mol
IUPAC name1-(4-bromophenyl)-2-oxopyridine-3-carboxylic acid
InChIKeyLTVQDBQFUUNCHE-UHFFFAOYSA-N
SMILESC1=CN(C(=O)C(=C1)C(=O)O)C2=CC=C(C=C2)Br

Computed by PubChem (NCBI)