CAS 1267544-59-1 appears in our catalog under these names: 2-(2-(2-Fluorophenyl)-1,3-thiazol-4-yl)-2-methylpropanoic acid, 95%, 2-(2-(2-Fluorophenyl)-1,3-thiazol-4-yl)-2-methylpropanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]-2-methylpropanoic acid (CAS 1267544-59-1) is a chemical compound with the molecular formula C13H12FNO2S and a molecular weight of 265.31 g/mol. IUPAC name: 2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]-2-methylpropanoic acid. InChIKey: HNNMEKLBMLMCBS-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO2S |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | 2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]-2-methylpropanoic acid |
| InChIKey | HNNMEKLBMLMCBS-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CSC(=N1)C2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)