CAS 1267584-71-3 appears in our catalog under these names: 5-Chloro-2-(4-fluorophenyl)pyrimidine-4-carboxylic acid 97%, 5-Chloro-2-(4-fluorophenyl)pyrimidine-4-carboxylic acid, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-chloro-2-(4-fluorophenyl)pyrimidine-4-carboxylic acid (CAS 1267584-71-3) is a chemical compound with the molecular formula C11H6ClFN2O2 and a molecular weight of 252.63 g/mol. IUPAC name: 5-chloro-2-(4-fluorophenyl)pyrimidine-4-carboxylic acid. InChIKey: IHRFXIVVUPPTQI-UHFFFAOYSA-N.
| Molecular formula | C11H6ClFN2O2 |
|---|---|
| Molecular weight | 252.63 g/mol |
| IUPAC name | 5-chloro-2-(4-fluorophenyl)pyrimidine-4-carboxylic acid |
| InChIKey | IHRFXIVVUPPTQI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(C(=N2)C(=O)O)Cl)F |
Computed by PubChem (NCBI)