CAS 126764-52-1 is the registry number for 2-(Chloromethyl)-6-(trifluoromethyl)benzo[d]thiazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(chloromethyl)-6-(trifluoromethyl)-1,3-benzothiazole (CAS 126764-52-1) is a chemical compound with the molecular formula C9H5ClF3NS and a molecular weight of 251.66 g/mol. IUPAC name: 2-(chloromethyl)-6-(trifluoromethyl)-1,3-benzothiazole. InChIKey: IXLDAGDFXYJTHI-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF3NS |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | 2-(chloromethyl)-6-(trifluoromethyl)-1,3-benzothiazole |
| InChIKey | IXLDAGDFXYJTHI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)SC(=N2)CCl |
Computed by PubChem (NCBI)