Products 126766-32-3
CAS 126766-32-3 appears in our catalog under these names: GR 89696, GR 89696 fumarate, GR 89696 fumarate/ 99.19% (existing batch purity), GR 89696 fumarate salt, GR-89696 FUMARATE. Offered by: TRC, GLPBio, TargetMol, Biosynth, Sigma-Aldrich. Available pack sizes: 25mg, 10mg, 50mg, 5mg, 100mg, 10mM/1mL, 5 mg.
(E)-but-2-enedioic acid;methyl 4-[2-(3,4-dichlorophenyl)acetyl]-3-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate (CAS 126766-32-3) is a chemical compound with the molecular formula C23H29Cl2N3O7 and a molecular weight of 530.4 g/mol. IUPAC name: (E)-but-2-enedioic acid;methyl 4-[2-(3,4-dichlorophenyl)acetyl]-3-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate. InChIKey: ABTNETSDXZBJTE-WLHGVMLRSA-N.
| Molecular formula | C23H29Cl2N3O7 |
|---|---|
| Molecular weight | 530.4 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;methyl 4-[2-(3,4-dichlorophenyl)acetyl]-3-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate |
| InChIKey | ABTNETSDXZBJTE-WLHGVMLRSA-N |
| SMILES | COC(=O)N1CCN(C(C1)CN2CCCC2)C(=O)CC3=CC(=C(C=C3)Cl)Cl.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)