Products 1268029-67-9

CAS 1268029-67-9 is the registry number for 5-(5-Bromo-2-thienyl)-1,3-oxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-(5-bromothiophen-2-yl)-1,3-oxazole (CAS 1268029-67-9) is a chemical compound with the molecular formula C7H4BrNOS and a molecular weight of 230.08 g/mol. IUPAC name: 5-(5-bromothiophen-2-yl)-1,3-oxazole. InChIKey: WXBMDCXPLFCGOY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BrNOS
Molecular weight230.08 g/mol
IUPAC name5-(5-bromothiophen-2-yl)-1,3-oxazole
InChIKeyWXBMDCXPLFCGOY-UHFFFAOYSA-N
SMILESC1=C(SC(=C1)Br)C2=CN=CO2

Computed by PubChem (NCBI)