CAS 1268077-02-6 is the registry number for 2-(2-(4-Fluorophenyl)thiazol-4-yl)-2-methylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-2-methylpropanoic acid (CAS 1268077-02-6) is a chemical compound with the molecular formula C13H12FNO2S and a molecular weight of 265.31 g/mol. IUPAC name: 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-2-methylpropanoic acid. InChIKey: NQRPHVIWLGEPOQ-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO2S |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-2-methylpropanoic acid |
| InChIKey | NQRPHVIWLGEPOQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CSC(=N1)C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)