CAS 1268118-96-2 is the registry number for 5-Bromo-4-(5-chlorothiophen-2-yl)thiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-amine (CAS 1268118-96-2) is a chemical compound with the molecular formula C7H4BrClN2S2 and a molecular weight of 295.6 g/mol. IUPAC name: 5-bromo-4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-amine. InChIKey: OOTULSHYGSZHGQ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2S2 |
|---|---|
| Molecular weight | 295.6 g/mol |
| IUPAC name | 5-bromo-4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-amine |
| InChIKey | OOTULSHYGSZHGQ-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Cl)C2=C(SC(=N2)N)Br |
Computed by PubChem (NCBI)