CAS 1268162-33-9 appears in our catalog under these names: Dibenzofuran-4-yl-diphenyl-phosphine-oxide, 99%, Dibenzo[b,d]furan-4-yldiphenylphosphine oxide, 99%, Poly((9,9-dioctylfluorenyl-2,7-diyl)-alt-(9-hexyl-3,6-carbazole)), Dibenzo(b,d)furan–4–yldiphenylphosphine oxide. Offered by: Lumtec, Chemat Brand, GLPBio. Available pack sizes: 1g, 2g, on request.
4-diphenylphosphoryldibenzofuran (CAS 1268162-33-9) is a chemical compound with the molecular formula C24H17O2P and a molecular weight of 368.4 g/mol. IUPAC name: 4-diphenylphosphoryldibenzofuran. InChIKey: ZLUJFDJLYLXPOY-UHFFFAOYSA-N.
| Molecular formula | C24H17O2P |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 4-diphenylphosphoryldibenzofuran |
| InChIKey | ZLUJFDJLYLXPOY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=CC=CC4=C3OC5=CC=CC=C45 |
Computed by PubChem (NCBI)