CAS 1268241-74-2 is the registry number for 2,4-Dichloropyrido[3',2':4,5]furo[3,2-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4,6-dichloro-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (CAS 1268241-74-2) is a chemical compound with the molecular formula C9H3Cl2N3O and a molecular weight of 240.04 g/mol. IUPAC name: 4,6-dichloro-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene. InChIKey: MNUHJWKPRZOOLM-UHFFFAOYSA-N.
| Molecular formula | C9H3Cl2N3O |
|---|---|
| Molecular weight | 240.04 g/mol |
| IUPAC name | 4,6-dichloro-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| InChIKey | MNUHJWKPRZOOLM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)OC3=C2N=C(N=C3Cl)Cl |
Computed by PubChem (NCBI)