CAS 1268244-88-7 appears in our catalog under these names: (–)–PX20606 trans isomer ((–)–PX–102 trans isomer), (-)-PX20606 trans isomer, (R,R)-PX20606. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mM (in 1ml dmso), 2mg, 5mg, 10mg, 25mg, 50mg, 2 mg.
4-[(1S,2S)-2-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]cyclopropyl]benzoic acid (CAS 1268244-88-7) is a chemical compound with the molecular formula C29H22Cl3NO4 and a molecular weight of 554.8 g/mol. IUPAC name: 4-[(1S,2S)-2-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]cyclopropyl]benzoic acid. InChIKey: XBUXXJUEBFDQHD-NHCUHLMSSA-N.
| Molecular formula | C29H22Cl3NO4 |
|---|---|
| Molecular weight | 554.8 g/mol |
| IUPAC name | 4-[(1S,2S)-2-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]cyclopropyl]benzoic acid |
| InChIKey | XBUXXJUEBFDQHD-NHCUHLMSSA-N |
| SMILES | C1CC1C2=C(C(=NO2)C3=C(C=CC=C3Cl)Cl)COC4=CC(=C(C=C4)[C@H]5C[C@@H]5C6=CC=C(C=C6)C(=O)O)Cl |
Computed by PubChem (NCBI)