CAS 1268257-44-8 appears in our catalog under these names: 2–Methyl–2–(trifluoromethylsulfonamido)propyl methacrylate, 2-Methyl-2-(trifluoromethylsulfonamido)propyl methacrylate 95%, 2-Methyl-2-(trifluoromethylsulfonamido)propyl methacrylate, 95%, 95%, 2-Methyl-2-(trifluoromethylsulfonamido)propyl methacrylate, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg.
[2-methyl-2-(trifluoromethylsulfonylamino)propyl] 2-methylprop-2-enoate (CAS 1268257-44-8) is a chemical compound with the molecular formula C9H14F3NO4S and a molecular weight of 289.27 g/mol. IUPAC name: [2-methyl-2-(trifluoromethylsulfonylamino)propyl] 2-methylprop-2-enoate. InChIKey: HQWREDMBXIRTBO-UHFFFAOYSA-N.
| Molecular formula | C9H14F3NO4S |
|---|---|
| Molecular weight | 289.27 g/mol |
| IUPAC name | [2-methyl-2-(trifluoromethylsulfonylamino)propyl] 2-methylprop-2-enoate |
| InChIKey | HQWREDMBXIRTBO-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC(C)(C)NS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)