CAS 126828-35-1 appears in our catalog under these names: Fmoc–2,4–dimethoxy–4'–(carboxymethyloxy)–benzhydrylamine, Fmoc-Rink Amide-Linker, 4-¬(2,4-Dimethoxyphenyl)(Fmoc-amino)methyl|phenoxyacetic aci, 4-[(2,4-Dimethoxyphenyl)[(9H-fluoren-9-ylmethoxy)carbonylamino]methyl]phenoxyacetic Acid, >98.0%(HPLC)(T), Fmoc-Rink amide linker 98%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 1g, 5g, 25g, 10g, 100g, 500g, 5 g, 50 g.
2-[4-[(2,4-dimethoxyphenyl)-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenoxy]acetic acid (CAS 126828-35-1) is a chemical compound with the molecular formula C32H29NO7 and a molecular weight of 539.6 g/mol. IUPAC name: 2-[4-[(2,4-dimethoxyphenyl)-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenoxy]acetic acid. InChIKey: UPMGJEMWPQOACJ-UHFFFAOYSA-N.
| Molecular formula | C32H29NO7 |
|---|---|
| Molecular weight | 539.6 g/mol |
| IUPAC name | 2-[4-[(2,4-dimethoxyphenyl)-(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenoxy]acetic acid |
| InChIKey | UPMGJEMWPQOACJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(C2=CC=C(C=C2)OCC(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)OC |
Computed by PubChem (NCBI)