Products 126840-02-6
CAS 126840-02-6 appears in our catalog under these names: 4-Methoxyphenol-2,3,5,6-d4,OD, 98 atom % D, min 98% Chemical Purity, Mequinol-d4, 98.9%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 5 mg, 10 mg, 25 mg, 50 mg.
1,2,4,5-tetradeuterio-3-deuteriooxy-6-methoxybenzene (CAS 126840-02-6) is a chemical compound with the molecular formula C7H8O2 and a molecular weight of 129.17 g/mol. IUPAC name: 1,2,4,5-tetradeuterio-3-deuteriooxy-6-methoxybenzene. InChIKey: NWVVVBRKAWDGAB-MDXQMYCFSA-N.
| Molecular formula | C7H8O2 |
|---|---|
| Molecular weight | 129.17 g/mol |
| IUPAC name | 1,2,4,5-tetradeuterio-3-deuteriooxy-6-methoxybenzene |
| InChIKey | NWVVVBRKAWDGAB-MDXQMYCFSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1O[2H])[2H])[2H])OC)[2H] |
Computed by PubChem (NCBI)