CAS 126840-36-6 appears in our catalog under these names: 1-Bromooctane-d17, 98 atom % D, min 98% Chemical Purity, 1-BROMOOCTANE-D17, 98 ATOM % D, 1-Bromooctane-d17. Offered by: CDN, Sigma-Aldrich, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 5G, 100 mg, 1 g, 250 mg, 50 mg.
1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctane (CAS 126840-36-6) is a chemical compound with the molecular formula C8H17Br and a molecular weight of 210.23 g/mol. IUPAC name: 1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctane. InChIKey: VMKOFRJSULQZRM-OISRNESJSA-N.
| Molecular formula | C8H17Br |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctane |
| InChIKey | VMKOFRJSULQZRM-OISRNESJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])Br |
Computed by PubChem (NCBI)