CAS 126849-31-8 appears in our catalog under these names: Bromfenac Impurity 23 Sodium Salt, Bromfenac Impurity B, Bromfenac Impurity 23, 2-Amino-3-benzoyl-alpha-oxo-benzeneacetic Acid Sodium Salt, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
Sodium 2-(2-amino-3-benzoylphenyl)-2-oxoacetate (CAS 126849-31-8) is a chemical compound with the molecular formula C15H10NNaO4 and a molecular weight of 291.23 g/mol. IUPAC name: sodium 2-(2-amino-3-benzoylphenyl)-2-oxoacetate. InChIKey: HMQAPOWQLASHPA-UHFFFAOYSA-M.
| Molecular formula | C15H10NNaO4 |
|---|---|
| Molecular weight | 291.23 g/mol |
| IUPAC name | sodium 2-(2-amino-3-benzoylphenyl)-2-oxoacetate |
| InChIKey | HMQAPOWQLASHPA-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C(=CC=C2)C(=O)C(=O)[O-])N.[Na+] |
Computed by PubChem (NCBI)