CAS 1268618-43-4 is the registry number for 3-((5-Bromo-2,3-dihydrobenzofuran)-7-sulfonamido)thiophene-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonylamino]thiophene-2-carboxylic acid (CAS 1268618-43-4) is a chemical compound with the molecular formula C13H10BrNO5S2 and a molecular weight of 404.3 g/mol. IUPAC name: 3-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonylamino]thiophene-2-carboxylic acid. InChIKey: VOGHAFYVRGZVRC-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO5S2 |
|---|---|
| Molecular weight | 404.3 g/mol |
| IUPAC name | 3-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonylamino]thiophene-2-carboxylic acid |
| InChIKey | VOGHAFYVRGZVRC-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2S(=O)(=O)NC3=C(SC=C3)C(=O)O)Br |
Computed by PubChem (NCBI)