Products 1268619-81-3
CAS 1268619-81-3 is the registry number for 3-(2-Chloropyridin-4-yloxy)-4-fluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[(2-chloro-4-pyridinyl)oxy]-4-fluorobenzoic acid (CAS 1268619-81-3) is a chemical compound with the molecular formula C12H7ClFNO3 and a molecular weight of 267.64 g/mol. IUPAC name: 3-[(2-chloro-4-pyridinyl)oxy]-4-fluorobenzoic acid. InChIKey: UTFGEGWNXLUHJK-UHFFFAOYSA-N.
| Molecular formula | C12H7ClFNO3 |
|---|---|
| Molecular weight | 267.64 g/mol |
| IUPAC name | 3-[(2-chloro-4-pyridinyl)oxy]-4-fluorobenzoic acid |
| InChIKey | UTFGEGWNXLUHJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)OC2=CC(=NC=C2)Cl)F |
Computed by PubChem (NCBI)