CAS 1268671-03-9 is the registry number for N2-(tert-Butoxycarbonyl)-n1-prop-2-yn-1-yl-l-leucinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 10g, 5g.
Tert-butyl N-[(2S)-4-methyl-1-oxo-1-(prop-2-ynylamino)pentan-2-yl]carbamate (CAS 1268671-03-9) is a chemical compound with the molecular formula C14H24N2O3 and a molecular weight of 268.35 g/mol. IUPAC name: tert-butyl N-[(2S)-4-methyl-1-oxo-1-(prop-2-ynylamino)pentan-2-yl]carbamate. InChIKey: ABHCKXYARHTQMR-NSHDSACASA-N.
| Molecular formula | C14H24N2O3 |
|---|---|
| Molecular weight | 268.35 g/mol |
| IUPAC name | tert-butyl N-[(2S)-4-methyl-1-oxo-1-(prop-2-ynylamino)pentan-2-yl]carbamate |
| InChIKey | ABHCKXYARHTQMR-NSHDSACASA-N |
| SMILES | CC(C)C[C@@H](C(=O)NCC#C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)