Products 1268720-66-6

CAS 1268720-66-6 appears in our catalog under these names: (4Z,7S,8E,10Z,12Z,14R,16Z,19Z)-7,14-Dihydroxydocosa-4,8,10,12,16,19-hexaenoic acid, 97%, (7S)-Maresin 1, 7-epi Maresin 1, 7–epi Maresin 1, 7(S)-Maresin 1. Offered by: Chemat Brand, TargetMol, GLPBio, MedChemExpress. Available pack sizes: on request, 10ug, 25ug, 50ug, 100ug, 10μg, 100μg, 25μg.

Structural formula: {0} (CAS {1})

(7S,14R)-7,14-dihydroxydocosa-4,8,10,12,16,19-hexaenoic acid (CAS 1268720-66-6) is a chemical compound with the molecular formula C22H32O4 and a molecular weight of 360.5 g/mol. IUPAC name: (7S,14R)-7,14-dihydroxydocosa-4,8,10,12,16,19-hexaenoic acid. InChIKey: HLHYXXBCQOUTGK-NHCUHLMSSA-N.

Identity
Molecular formulaC22H32O4
Molecular weight360.5 g/mol
IUPAC name(7S,14R)-7,14-dihydroxydocosa-4,8,10,12,16,19-hexaenoic acid
InChIKeyHLHYXXBCQOUTGK-NHCUHLMSSA-N
SMILESCCC=CCC=CC[C@H](C=CC=CC=C[C@H](CC=CCCC(=O)O)O)O

Computed by PubChem (NCBI)