CAS 1268883-31-3 is the registry number for (R)-2,2-Dimethyl-1-(pyridin-2-yl)propan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-2,2-dimethyl-1-pyridin-2-ylpropan-1-amine (CAS 1268883-31-3) is a chemical compound with the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. IUPAC name: (1R)-2,2-dimethyl-1-pyridin-2-ylpropan-1-amine. InChIKey: OUHQNKPDMOMQIH-VIFPVBQESA-N.
| Molecular formula | C10H16N2 |
|---|---|
| Molecular weight | 164.25 g/mol |
| IUPAC name | (1R)-2,2-dimethyl-1-pyridin-2-ylpropan-1-amine |
| InChIKey | OUHQNKPDMOMQIH-VIFPVBQESA-N |
| SMILES | CC(C)(C)[C@H](C1=CC=CC=N1)N |
Computed by PubChem (NCBI)