CAS 1268982-24-6 appears in our catalog under these names: [2-(2-Methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)ethyl]amine dihydrochloride, 95%, 2-(2-Methylimidazo(2,1-b)(1,3,4)thiadiazol-6-yl)ethanamine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.
2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)ethanamine;dihydrochloride (CAS 1268982-24-6) is a chemical compound with the molecular formula C7H12Cl2N4S and a molecular weight of 255.17 g/mol. IUPAC name: 2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)ethanamine;dihydrochloride. InChIKey: GVZCKLSNHXCTLZ-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N4S |
|---|---|
| Molecular weight | 255.17 g/mol |
| IUPAC name | 2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)ethanamine;dihydrochloride |
| InChIKey | GVZCKLSNHXCTLZ-UHFFFAOYSA-N |
| SMILES | CC1=NN2C=C(N=C2S1)CCN.Cl.Cl |
Computed by PubChem (NCBI)