Products 1269054-03-6

CAS 1269054-03-6 is the registry number for N,N-Diethyl-4-piperidinecarboxamide nitrate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

N,N-diethylpiperidine-4-carboxamide;nitric acid (CAS 1269054-03-6) is a chemical compound with the molecular formula C10H21N3O4 and a molecular weight of 247.29 g/mol. IUPAC name: N,N-diethylpiperidine-4-carboxamide;nitric acid. InChIKey: MEAWOBDOKAMJAX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H21N3O4
Molecular weight247.29 g/mol
IUPAC nameN,N-diethylpiperidine-4-carboxamide;nitric acid
InChIKeyMEAWOBDOKAMJAX-UHFFFAOYSA-N
SMILESCCN(CC)C(=O)C1CCNCC1.[N+](=O)(O)[O-]

Computed by PubChem (NCBI)