CAS 1269110-12-4 is the registry number for D574-0246, 99.9500%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 10 mg, 50 mg, 10mM/1mL, 5 mg, 25 mg.
N-(1,3-benzodioxol-5-yl)-4-[6-methyl-2-(4-methylanilino)pyrimidin-4-yl]piperazine-1-carboxamide (CAS 1269110-12-4) is a chemical compound with the molecular formula C24H26N6O3 and a molecular weight of 446.5 g/mol. IUPAC name: N-(1,3-benzodioxol-5-yl)-4-[6-methyl-2-(4-methylanilino)pyrimidin-4-yl]piperazine-1-carboxamide. InChIKey: XSOHLLSQEYPNAQ-UHFFFAOYSA-N.
| Molecular formula | C24H26N6O3 |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-yl)-4-[6-methyl-2-(4-methylanilino)pyrimidin-4-yl]piperazine-1-carboxamide |
| InChIKey | XSOHLLSQEYPNAQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=NC(=CC(=N2)N3CCN(CC3)C(=O)NC4=CC5=C(C=C4)OCO5)C |
Computed by PubChem (NCBI)