CAS 1269151-44-1 appears in our catalog under these names: 2-Chloro-N-(2,2-dimethyl-1-(thiophen-2-yl)propyl)acetamide, 95%, 2-Chloro-N-(2,2-dimethyl-1-(thiophen-2-yl)propyl)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-chloro-N-(2,2-dimethyl-1-thiophen-2-ylpropyl)acetamide (CAS 1269151-44-1) is a chemical compound with the molecular formula C11H16ClNOS and a molecular weight of 245.77 g/mol. IUPAC name: 2-chloro-N-(2,2-dimethyl-1-thiophen-2-ylpropyl)acetamide. InChIKey: OCXXRBZSXWQDMR-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNOS |
|---|---|
| Molecular weight | 245.77 g/mol |
| IUPAC name | 2-chloro-N-(2,2-dimethyl-1-thiophen-2-ylpropyl)acetamide |
| InChIKey | OCXXRBZSXWQDMR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=CC=CS1)NC(=O)CCl |
Computed by PubChem (NCBI)