CAS 1269151-46-3 appears in our catalog under these names: 2-(Ethylamino)-2-(pyridin-3-yl)ethanethioamide dihydrochloride, 2-(Ethylamino)-2-(pyridin-3-yl)ethanethioamide dihydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g.
2-(ethylamino)-2-pyridin-3-ylethanethioamide;dihydrochloride (CAS 1269151-46-3) is a chemical compound with the molecular formula C9H15Cl2N3S and a molecular weight of 268.21 g/mol. IUPAC name: 2-(ethylamino)-2-pyridin-3-ylethanethioamide;dihydrochloride. InChIKey: OHJVZUSMEUMLCV-UHFFFAOYSA-N.
| Molecular formula | C9H15Cl2N3S |
|---|---|
| Molecular weight | 268.21 g/mol |
| IUPAC name | 2-(ethylamino)-2-pyridin-3-ylethanethioamide;dihydrochloride |
| InChIKey | OHJVZUSMEUMLCV-UHFFFAOYSA-N |
| SMILES | CCNC(C1=CN=CC=C1)C(=S)N.Cl.Cl |
Computed by PubChem (NCBI)