CAS 1269151-64-5 appears in our catalog under these names: 2-Chloro-N-{(1-(4-fluorophenyl)cyclopentyl)methyl}acetamide, 95%, 2-Chloro-N-{(1-(4-fluorophenyl)cyclopentyl)methyl}acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-chloro-N-[[1-(4-fluorophenyl)cyclopentyl]methyl]acetamide (CAS 1269151-64-5) is a chemical compound with the molecular formula C14H17ClFNO and a molecular weight of 269.74 g/mol. IUPAC name: 2-chloro-N-[[1-(4-fluorophenyl)cyclopentyl]methyl]acetamide. InChIKey: YJQVSNWIFJWTLD-UHFFFAOYSA-N.
| Molecular formula | C14H17ClFNO |
|---|---|
| Molecular weight | 269.74 g/mol |
| IUPAC name | 2-chloro-N-[[1-(4-fluorophenyl)cyclopentyl]methyl]acetamide |
| InChIKey | YJQVSNWIFJWTLD-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(CNC(=O)CCl)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)