CAS 1269151-87-2 is the registry number for 2-(6-fluoro-1-methyl-1H-1,3-benzodiazol-2-yl)ethan-1-amine dihydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 50mg, 0,5g.
2-(6-fluoro-1-methylbenzimidazol-2-yl)ethanamine;dihydrochloride (CAS 1269151-87-2) is a chemical compound with the molecular formula C10H14Cl2FN3 and a molecular weight of 266.14 g/mol. IUPAC name: 2-(6-fluoro-1-methylbenzimidazol-2-yl)ethanamine;dihydrochloride. InChIKey: PFWTZLRTUZFORA-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2FN3 |
|---|---|
| Molecular weight | 266.14 g/mol |
| IUPAC name | 2-(6-fluoro-1-methylbenzimidazol-2-yl)ethanamine;dihydrochloride |
| InChIKey | PFWTZLRTUZFORA-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)F)N=C1CCN.Cl.Cl |
Computed by PubChem (NCBI)