CAS 1269152-33-1 is the registry number for 2,2,2-Trifluoroethyl N-(4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2,2,2-trifluoroethyl N-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]carbamate (CAS 1269152-33-1) is a chemical compound with the molecular formula C10H8F3N3O2S and a molecular weight of 291.25 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]carbamate. InChIKey: HZZBNZTYCCOILI-UHFFFAOYSA-N.
| Molecular formula | C10H8F3N3O2S |
|---|---|
| Molecular weight | 291.25 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]carbamate |
| InChIKey | HZZBNZTYCCOILI-UHFFFAOYSA-N |
| SMILES | C1=CNC(=C1)C2=CSC(=N2)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)