CAS 1269259-37-1 is the registry number for 4-Amino-1-hexylpyridinium Bromide. Offered by: TRC. Available pack sizes: 750mg.
1-hexylpyridin-1-ium-4-amine bromide (CAS 1269259-37-1) is a chemical compound with the molecular formula C11H19BrN2 and a molecular weight of 259.19 g/mol. IUPAC name: 1-hexylpyridin-1-ium-4-amine bromide. InChIKey: LSWPDXUFUPYICY-UHFFFAOYSA-N.
| Molecular formula | C11H19BrN2 |
|---|---|
| Molecular weight | 259.19 g/mol |
| IUPAC name | 1-hexylpyridin-1-ium-4-amine bromide |
| InChIKey | LSWPDXUFUPYICY-UHFFFAOYSA-N |
| SMILES | CCCCCC[N+]1=CC=C(C=C1)N.[Br-] |
Computed by PubChem (NCBI)