CAS 1269294-04-3 is the registry number for Ethyl-1-tert-butyl-5-fluoro-1H-pyrazole-3-carboxylate. Offered by: TRC. Available pack sizes: 2,5g.
Ethyl 1-tert-butyl-5-fluoropyrazole-3-carboxylate (CAS 1269294-04-3) is a chemical compound with the molecular formula C10H15FN2O2 and a molecular weight of 214.24 g/mol. IUPAC name: ethyl 1-tert-butyl-5-fluoropyrazole-3-carboxylate. InChIKey: IDLCEOOTQCUMCY-UHFFFAOYSA-N.
| Molecular formula | C10H15FN2O2 |
|---|---|
| Molecular weight | 214.24 g/mol |
| IUPAC name | ethyl 1-tert-butyl-5-fluoropyrazole-3-carboxylate |
| InChIKey | IDLCEOOTQCUMCY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C(=C1)F)C(C)(C)C |
Computed by PubChem (NCBI)