CAS 1269363-88-3 is the registry number for CHIKV-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-bromophenyl)-[4-[2-(ethylamino)-6-methylpyrimidin-4-yl]piperazin-1-yl]methanone (CAS 1269363-88-3) is a chemical compound with the molecular formula C18H22BrN5O and a molecular weight of 404.3 g/mol. IUPAC name: (4-bromophenyl)-[4-[2-(ethylamino)-6-methylpyrimidin-4-yl]piperazin-1-yl]methanone. InChIKey: VQDRALXYLFZGFB-UHFFFAOYSA-N.
| Molecular formula | C18H22BrN5O |
|---|---|
| Molecular weight | 404.3 g/mol |
| IUPAC name | (4-bromophenyl)-[4-[2-(ethylamino)-6-methylpyrimidin-4-yl]piperazin-1-yl]methanone |
| InChIKey | VQDRALXYLFZGFB-UHFFFAOYSA-N |
| SMILES | CCNC1=NC(=CC(=N1)N2CCN(CC2)C(=O)C3=CC=C(C=C3)Br)C |
Computed by PubChem (NCBI)