CAS 1269365-82-3 appears in our catalog under these names: DIPQUO, 99+%, DIPQUO, DIPQUO, 98.12%, 98.12%, DIPQUO, 98.70%. Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 1mg, 5mg, 10mg, 50 mg, 100 mg.
6,8-dimethyl-3-(4-phenyl-1H-imidazol-5-yl)-1H-quinolin-2-one (CAS 1269365-82-3) is a chemical compound with the molecular formula C20H17N3O and a molecular weight of 315.4 g/mol. IUPAC name: 6,8-dimethyl-3-(4-phenyl-1H-imidazol-5-yl)-1H-quinolin-2-one. InChIKey: KTMBLNYSLKFCIR-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 6,8-dimethyl-3-(4-phenyl-1H-imidazol-5-yl)-1H-quinolin-2-one |
| InChIKey | KTMBLNYSLKFCIR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C=C(C(=O)N2)C3=C(N=CN3)C4=CC=CC=C4)C |
Computed by PubChem (NCBI)