CAS 1269726-67-1 appears in our catalog under these names: Dapaconazole, Dapaconazole, 97%, Dapaconazole, 98%, 98%, Dapaconazole, 99.76%. Offered by: GLPBio, Chemat Brand, AmBeed, Chemat, MedChemExpress. Available pack sizes: 1mg, on request, 100mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 5 mg.
1-[2-(2,4-dichlorophenyl)-2-[[4-(trifluoromethyl)phenyl]methoxy]ethyl]imidazole (CAS 1269726-67-1) is a chemical compound with the molecular formula C19H15Cl2F3N2O and a molecular weight of 415.2 g/mol. IUPAC name: 1-[2-(2,4-dichlorophenyl)-2-[[4-(trifluoromethyl)phenyl]methoxy]ethyl]imidazole. InChIKey: FUAHXHWSMYFWGE-UHFFFAOYSA-N.
| Molecular formula | C19H15Cl2F3N2O |
|---|---|
| Molecular weight | 415.2 g/mol |
| IUPAC name | 1-[2-(2,4-dichlorophenyl)-2-[[4-(trifluoromethyl)phenyl]methoxy]ethyl]imidazole |
| InChIKey | FUAHXHWSMYFWGE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)