Products 1269757-30-3

CAS 1269757-30-3 is the registry number for Rel-1-benzyl 3-methyl (3R,5R)-5-fluoropiperidine-1,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O-benzyl 3-O-methyl (3R,5R)-5-fluoropiperidine-1,3-dicarboxylate (CAS 1269757-30-3) is a chemical compound with the molecular formula C15H18FNO4 and a molecular weight of 295.31 g/mol. IUPAC name: 1-O-benzyl 3-O-methyl (3R,5R)-5-fluoropiperidine-1,3-dicarboxylate. InChIKey: SWLLCPKZQDGIRB-CHWSQXEVSA-N.

Identity
Molecular formulaC15H18FNO4
Molecular weight295.31 g/mol
IUPAC name1-O-benzyl 3-O-methyl (3R,5R)-5-fluoropiperidine-1,3-dicarboxylate
InChIKeySWLLCPKZQDGIRB-CHWSQXEVSA-N
SMILESCOC(=O)[C@@H]1C[C@H](CN(C1)C(=O)OCC2=CC=CC=C2)F

Computed by PubChem (NCBI)