CAS 1269780-39-3 is the registry number for (S)-2-(4-Chloro-2,5-difluorophenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(4-chloro-2,5-difluorophenyl)pyrrolidine (CAS 1269780-39-3) is a chemical compound with the molecular formula C10H10ClF2N and a molecular weight of 217.64 g/mol. IUPAC name: (2S)-2-(4-chloro-2,5-difluorophenyl)pyrrolidine. InChIKey: JVRFZCCKAAAWTJ-JTQLQIEISA-N.
| Molecular formula | C10H10ClF2N |
|---|---|
| Molecular weight | 217.64 g/mol |
| IUPAC name | (2S)-2-(4-chloro-2,5-difluorophenyl)pyrrolidine |
| InChIKey | JVRFZCCKAAAWTJ-JTQLQIEISA-N |
| SMILES | C1C[C@H](NC1)C2=CC(=C(C=C2F)Cl)F |
Computed by PubChem (NCBI)