Products 1269794-89-9
CAS 1269794-89-9 appears in our catalog under these names: GCPII–IN–1 TFA, GCPII-IN-1 (TFA), 99.58%, GCPII-IN-1 TFA, 98%, (((S)-5-Amino-1-carboxypentyl)carbamoyl)-L-glutamic acid compound with 2,2,2-trifluoroacetic acid (1:1), 98%, (((S)-5-Amino-1-carboxypentyl)carbamoyl)-L-glutamic acid compound with 2,2,2-trifluoroacetic acid, 98%. Offered by: GLPBio, MedChemExpress, Ambeed, BLDpharm, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 10 mg, 5 mg, 100mg, 250mg, 1mg.
(2S)-2-[[(1S)-5-amino-1-carboxypentyl]carbamoylamino]pentanedioic acid;2,2,2-trifluoroacetic acid (CAS 1269794-89-9) is a chemical compound with the molecular formula C14H22F3N3O9 and a molecular weight of 433.33 g/mol. IUPAC name: (2S)-2-[[(1S)-5-amino-1-carboxypentyl]carbamoylamino]pentanedioic acid;2,2,2-trifluoroacetic acid. InChIKey: FNWDAQBGACVZNV-WSZWBAFRSA-N.
| Molecular formula | C14H22F3N3O9 |
|---|---|
| Molecular weight | 433.33 g/mol |
| IUPAC name | (2S)-2-[[(1S)-5-amino-1-carboxypentyl]carbamoylamino]pentanedioic acid;2,2,2-trifluoroacetic acid |
| InChIKey | FNWDAQBGACVZNV-WSZWBAFRSA-N |
| SMILES | C(CCN)C[C@@H](C(=O)O)NC(=O)N[C@@H](CCC(=O)O)C(=O)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)