Products 1269839-24-8
CAS 1269839-24-8 appears in our catalog under these names: 5-Hydroxy-1,7-bis(4-hydroxyphenyl)heptan-3-yl acetate, 5-Hydroxy-1,7-bis(4-hydroxyphenyl)heptan-3-yl acetate, 95%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 50mg, Get quote, 5mg.
[(3R,5R)-5-hydroxy-1,7-bis(4-hydroxyphenyl)heptan-3-yl] acetate (CAS 1269839-24-8) is a chemical compound with the molecular formula C21H26O5 and a molecular weight of 358.4 g/mol. IUPAC name: [(3R,5R)-5-hydroxy-1,7-bis(4-hydroxyphenyl)heptan-3-yl] acetate. InChIKey: FMFLPOLVWWPIPP-NHCUHLMSSA-N.
| Molecular formula | C21H26O5 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | [(3R,5R)-5-hydroxy-1,7-bis(4-hydroxyphenyl)heptan-3-yl] acetate |
| InChIKey | FMFLPOLVWWPIPP-NHCUHLMSSA-N |
| SMILES | CC(=O)O[C@H](CCC1=CC=C(C=C1)O)C[C@@H](CCC2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)