CAS 1269845-43-3 is the registry number for L-m-(N,N-dimethylamino)phenylalanine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-[3-(dimethylamino)phenyl]propanoic acid (CAS 1269845-43-3) is a chemical compound with the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. IUPAC name: (2S)-2-amino-3-[3-(dimethylamino)phenyl]propanoic acid. InChIKey: GUFQMBAVCVFBRI-JTQLQIEISA-N.
| Molecular formula | C11H16N2O2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | (2S)-2-amino-3-[3-(dimethylamino)phenyl]propanoic acid |
| InChIKey | GUFQMBAVCVFBRI-JTQLQIEISA-N |
| SMILES | CN(C)C1=CC=CC(=C1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)