CAS 127-20-8 appears in our catalog under these names: Sodium 2,2–Dichloropropionate, Sodium 2,2-Dichloropropionate, >85.0%(T), 2,2-Dichloropropionicacid sodium salt, ≥85%(T), ≥85%(T). Offered by: GLPBio, TCI, Chemat. Available pack sizes: 25g, 5g.
Sodium 2,2-dichloropropanoate (CAS 127-20-8) is a chemical compound with the molecular formula C3H3Cl2NaO2 and a molecular weight of 164.95 g/mol. IUPAC name: sodium 2,2-dichloropropanoate. InChIKey: PDEFQWNXOUGDJR-UHFFFAOYSA-M.
| Molecular formula | C3H3Cl2NaO2 |
|---|---|
| Molecular weight | 164.95 g/mol |
| IUPAC name | sodium 2,2-dichloropropanoate |
| InChIKey | PDEFQWNXOUGDJR-UHFFFAOYSA-M |
| SMILES | CC(C(=O)[O-])(Cl)Cl.[Na+] |
Computed by PubChem (NCBI)