CAS 127-52-6 appears in our catalog under these names: N-Chlorobenzenesulfonamide sodium salt, 95%, N-CHLOROBENZENESULFONAMIDE SODIUM SALT. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 100g, 25g, 5g, 1g, 500G.
Sodium benzenesulfonyl(chloro)azanide (CAS 127-52-6) is a chemical compound with the molecular formula C6H5ClNNaO2S and a molecular weight of 213.62 g/mol. IUPAC name: sodium benzenesulfonyl(chloro)azanide. InChIKey: KDNCILYKSYKEFJ-UHFFFAOYSA-N.
| Molecular formula | C6H5ClNNaO2S |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | sodium benzenesulfonyl(chloro)azanide |
| InChIKey | KDNCILYKSYKEFJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)[N-]Cl.[Na+] |
Computed by PubChem (NCBI)