CAS 1270275-12-1 is the registry number for (S)-2-(3-Bromo-5-(trifluoromethyl)phenyl)piperidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[3-bromo-5-(trifluoromethyl)phenyl]piperidine (CAS 1270275-12-1) is a chemical compound with the molecular formula C12H13BrF3N and a molecular weight of 308.14 g/mol. IUPAC name: (2S)-2-[3-bromo-5-(trifluoromethyl)phenyl]piperidine. InChIKey: VFUFBXJWEXREQE-NSHDSACASA-N.
| Molecular formula | C12H13BrF3N |
|---|---|
| Molecular weight | 308.14 g/mol |
| IUPAC name | (2S)-2-[3-bromo-5-(trifluoromethyl)phenyl]piperidine |
| InChIKey | VFUFBXJWEXREQE-NSHDSACASA-N |
| SMILES | C1CCN[C@@H](C1)C2=CC(=CC(=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)