CAS 1270292-77-7 is the registry number for (1R)-4-Fluoro-2,3-dihydro-1H-inden-1-ol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(1R)-4-fluoro-2,3-dihydro-1H-inden-1-ol (CAS 1270292-77-7) is a chemical compound with the molecular formula C9H9FO and a molecular weight of 152.16 g/mol. IUPAC name: (1R)-4-fluoro-2,3-dihydro-1H-inden-1-ol. InChIKey: ORUNCRYHQOWNDO-SECBINFHSA-N.
| Molecular formula | C9H9FO |
|---|---|
| Molecular weight | 152.16 g/mol |
| IUPAC name | (1R)-4-fluoro-2,3-dihydro-1H-inden-1-ol |
| InChIKey | ORUNCRYHQOWNDO-SECBINFHSA-N |
| SMILES | C1CC2=C([C@@H]1O)C=CC=C2F |
Computed by PubChem (NCBI)