CAS 1270300-80-5 appears in our catalog under these names: N-Fmoc-3-fluoro-D-tyrosine, 95%, Fmoc-D-Tyr(3-F)-OH 95%. Offered by: AmBeed. Available pack sizes: 1g, 100mg, 250mg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-fluoro-4-hydroxyphenyl)propanoic acid (CAS 1270300-80-5) is a chemical compound with the molecular formula C24H20FNO5 and a molecular weight of 421.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-fluoro-4-hydroxyphenyl)propanoic acid. InChIKey: VNQUEERXNCSBHF-OAQYLSRUSA-N.
| Molecular formula | C24H20FNO5 |
|---|---|
| Molecular weight | 421.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-fluoro-4-hydroxyphenyl)propanoic acid |
| InChIKey | VNQUEERXNCSBHF-OAQYLSRUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC(=C(C=C4)O)F)C(=O)O |
Computed by PubChem (NCBI)