CAS 1270435-39-6 appears in our catalog under these names: 1-Amino-4-fluoro-2,3-dihydro-1h-indene-1-carboxylic acid, 95%, 1-Amino-4-fluoro-2,3-dihydro-1H-indene-1-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
1-amino-4-fluoro-2,3-dihydroindene-1-carboxylic acid (CAS 1270435-39-6) is a chemical compound with the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. IUPAC name: 1-amino-4-fluoro-2,3-dihydroindene-1-carboxylic acid. InChIKey: MPLCCXVYNVJNTL-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO2 |
|---|---|
| Molecular weight | 195.19 g/mol |
| IUPAC name | 1-amino-4-fluoro-2,3-dihydroindene-1-carboxylic acid |
| InChIKey | MPLCCXVYNVJNTL-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C1C(=CC=C2)F)(C(=O)O)N |
Computed by PubChem (NCBI)