CAS 1270480-19-7 appears in our catalog under these names: 1-(3,5-Dichlorophenyl)-3,3,3-trifluoropropan-1-amine, 95%, 1-(3,5-Dichlorophenyl)-3,3,3-trifluoropropan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(3,5-dichlorophenyl)-3,3,3-trifluoropropan-1-amine (CAS 1270480-19-7) is a chemical compound with the molecular formula C9H8Cl2F3N and a molecular weight of 258.06 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)-3,3,3-trifluoropropan-1-amine. InChIKey: ZNLHMXGTUGHXOO-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2F3N |
|---|---|
| Molecular weight | 258.06 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)-3,3,3-trifluoropropan-1-amine |
| InChIKey | ZNLHMXGTUGHXOO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(CC(F)(F)F)N |
Computed by PubChem (NCBI)